C32H32Cl2F2N4O3 — CID 169265072
4-amino-N-[2-cyclohexa-2,4-dien-1-yl-2-[6-(2,3-dichlorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-3-[(E)-difluoromethyliminomethyl]-5-methoxybenzamide (PubChem CID 169265072) has the molecular formula C32H32Cl2F2N4O3 and a molecular weight of 629.54 g/mol. Its IUPAC name is 4-amino-N-[2-cyclohexa-2,4-dien-1-yl-2-[6-(2,3-dichlorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-3-[(E)-difluoromethyliminomethyl]-5-methoxybenzamide.
| Compound Name | 4-amino-N-[2-cyclohexa-2,4-dien-1-yl-2-[6-(2,3-dichlorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-3-[(E)-difluoromethyliminomethyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 169265072 |
| Molecular Formula | C32H32Cl2F2N4O3 |
| Molecular Weight | 629.54 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | 4-amino-N-[2-cyclohexa-2,4-dien-1-yl-2-[6-(2,3-dichlorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]ethyl]-3-[(E)-difluoromethyliminomethyl]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(c2cc(C(C)(C)O)cc(-c3cccc(Cl)c3Cl)n2)C2C=CC=CC2)cc(/C=N/C(F)F)c1N |
| InChI | InChI=1S/C32H32Cl2F2N4O3/c1-32(2,42)21-14-25(22-10-7-11-24(33)28(22)34)40-26(15-21)23(18-8-5-4-6-9-18)17-38-30(41)19-12-20(16-39-31(35)36)29(37)27(13-19)43-3/h4-8,10-16,18,23,31,42H,9,17,37H2,1-3H3,(H,38,41)/b39-16+ |
| InChIKey | UCMYIXZARRIYML-RBWYEQHESA-N |
| XLogP | 7.16 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.54 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|