C10H10BrF2NO — CID 169267474
[1-(5-bromo-2-pyridinyl)-3,3-difluorocyclobutyl]methanol (PubChem CID 169267474) has the molecular formula C10H10BrF2NO and a molecular weight of 278.10 g/mol. Its IUPAC name is [1-(5-bromo-2-pyridinyl)-3,3-difluorocyclobutyl]methanol.
| Compound Name | [1-(5-bromo-2-pyridinyl)-3,3-difluorocyclobutyl]methanol |
|---|---|
| PubChem CID | 169267474 |
| Molecular Formula | C10H10BrF2NO |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | [1-(5-bromo-2-pyridinyl)-3,3-difluorocyclobutyl]methanol |
| SMILES | OCC1(c2ccc(Br)cn2)CC(F)(F)C1 |
| InChI | InChI=1S/C10H10BrF2NO/c11-7-1-2-8(14-3-7)9(6-15)4-10(12,13)5-9/h1-3,15H,4-6H2 |
| InChIKey | OAJKUEBDHMXQMW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |