C8H8BrNO3S — CID 86713186
3-(5-bromo-2-pyridinyl)-1,1-dioxothietan-3-ol (PubChem CID 86713186) has the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. Its IUPAC name is 3-(5-bromo-2-pyridinyl)-1,1-dioxothietan-3-ol.
| Compound Name | 3-(5-bromo-2-pyridinyl)-1,1-dioxothietan-3-ol |
|---|---|
| PubChem CID | 86713186 |
| Molecular Formula | C8H8BrNO3S |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 3-(5-bromo-2-pyridinyl)-1,1-dioxothietan-3-ol |
| SMILES | O=S1(=O)CC(O)(c2ccc(Br)cn2)C1 |
| InChI | InChI=1S/C8H8BrNO3S/c9-6-1-2-7(10-3-6)8(11)4-14(12,13)5-8/h1-3,11H,4-5H2 |
| InChIKey | YWJHAFAWORXDTC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |