C27H23F3N4O5S — CID 169271122
4-[4-[3-[2-(5-hydroxy-3-pyridinyl)ethynyl]-5-(trifluoromethyl)benzoyl]piperazin-1-yl]-N-methylsulfonylbenzamide (PubChem CID 169271122) has the molecular formula C27H23F3N4O5S and a molecular weight of 572.57 g/mol. Its IUPAC name is 4-[4-[3-[2-(5-hydroxy-3-pyridinyl)ethynyl]-5-(trifluoromethyl)benzoyl]piperazin-1-yl]-N-methylsulfonylbenzamide.
| Compound Name | 4-[4-[3-[2-(5-hydroxy-3-pyridinyl)ethynyl]-5-(trifluoromethyl)benzoyl]piperazin-1-yl]-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 169271122 |
| Molecular Formula | C27H23F3N4O5S |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | 4-[4-[3-[2-(5-hydroxy-3-pyridinyl)ethynyl]-5-(trifluoromethyl)benzoyl]piperazin-1-yl]-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(N2CCN(C(=O)c3cc(C#Cc4cncc(O)c4)cc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H23F3N4O5S/c1-40(38,39)32-25(36)20-4-6-23(7-5-20)33-8-10-34(11-9-33)26(37)21-12-18(13-22(15-21)27(28,29)30)2-3-19-14-24(35)17-31-16-19/h4-7,12-17,35H,8-11H2,1H3,(H,32,36) |
| InChIKey | KIICXFGPLAVRIH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|