C31H31F3N4O3 — CID 169272742
4-[4-[3-[2-(5-ethoxy-3-pyridinyl)ethynyl]-5-(trifluoromethyl)benzoyl]piperazin-1-yl]-N-propylbenzamide (PubChem CID 169272742) has the molecular formula C31H31F3N4O3 and a molecular weight of 564.61 g/mol. Its IUPAC name is 4-[4-[3-[2-(5-ethoxy-3-pyridinyl)ethynyl]-5-(trifluoromethyl)benzoyl]piperazin-1-yl]-N-propylbenzamide.
| Compound Name | 4-[4-[3-[2-(5-ethoxy-3-pyridinyl)ethynyl]-5-(trifluoromethyl)benzoyl]piperazin-1-yl]-N-propylbenzamide |
|---|---|
| PubChem CID | 169272742 |
| Molecular Formula | C31H31F3N4O3 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 4-[4-[3-[2-(5-ethoxy-3-pyridinyl)ethynyl]-5-(trifluoromethyl)benzoyl]piperazin-1-yl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(N2CCN(C(=O)c3cc(C#Cc4cncc(OCC)c4)cc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C31H31F3N4O3/c1-3-11-36-29(39)24-7-9-27(10-8-24)37-12-14-38(15-13-37)30(40)25-16-22(17-26(19-25)31(32,33)34)5-6-23-18-28(41-4-2)21-35-20-23/h7-10,16-21H,3-4,11-15H2,1-2H3,(H,36,39) |
| InChIKey | UHFCIBMXBPCBTJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|