C30H28F3N3O3 — CID 169272202
4-[4-[2-[2-(3-ethoxyphenyl)ethynyl]benzoyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 169272202) has the molecular formula C30H28F3N3O3 and a molecular weight of 535.57 g/mol. Its IUPAC name is 4-[4-[2-[2-(3-ethoxyphenyl)ethynyl]benzoyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[4-[2-[2-(3-ethoxyphenyl)ethynyl]benzoyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 169272202 |
| Molecular Formula | C30H28F3N3O3 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 4-[4-[2-[2-(3-ethoxyphenyl)ethynyl]benzoyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCOc1cccc(C#Cc2ccccc2C(=O)N2CCN(c3ccc(C(=O)NCC(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C30H28F3N3O3/c1-2-39-26-8-5-6-22(20-26)10-11-23-7-3-4-9-27(23)29(38)36-18-16-35(17-19-36)25-14-12-24(13-15-25)28(37)34-21-30(31,32)33/h3-9,12-15,20H,2,16-19,21H2,1H3,(H,34,37) |
| InChIKey | NMRPGMAWNOGPSB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|