C28H26F3N3O2 — CID 178064464
4-[4-[[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 178064464) has the molecular formula C28H26F3N3O2 and a molecular weight of 493.53 g/mol. Its IUPAC name is 4-[4-[[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[4-[[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 178064464 |
| Molecular Formula | C28H26F3N3O2 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 4-[4-[[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(N2CCN(Cc3ccccc3C#Cc3cccc(O)c3)CC2)cc1 |
| InChI | InChI=1S/C28H26F3N3O2/c29-28(30,31)20-32-27(36)23-10-12-25(13-11-23)34-16-14-33(15-17-34)19-24-6-2-1-5-22(24)9-8-21-4-3-7-26(35)18-21/h1-7,10-13,18,35H,14-17,19-20H2,(H,32,36) |
| InChIKey | OTOSMOHHDUWFHK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|