C30H33N3O2 — CID 169271267
N,N-diethyl-4-[4-[[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 169271267) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is N,N-diethyl-4-[4-[[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N,N-diethyl-4-[4-[[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 169271267 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N,N-diethyl-4-[4-[[2-[2-(3-hydroxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N2CCN(Cc3ccccc3C#Cc3cccc(O)c3)CC2)cc1 |
| InChI | InChI=1S/C30H33N3O2/c1-3-32(4-2)30(35)26-14-16-28(17-15-26)33-20-18-31(19-21-33)23-27-10-6-5-9-25(27)13-12-24-8-7-11-29(34)22-24/h5-11,14-17,22,34H,3-4,18-21,23H2,1-2H3 |
| InChIKey | PCCAPFIWVFHFGP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|