C26H28N6O2 — CID 169271787
6-[4-[[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]phenyl]methyl]piperazin-1-yl]-N-propylpyridazine-3-carboxamide (PubChem CID 169271787) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 6-[4-[[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]phenyl]methyl]piperazin-1-yl]-N-propylpyridazine-3-carboxamide.
| Compound Name | 6-[4-[[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]phenyl]methyl]piperazin-1-yl]-N-propylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169271787 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 6-[4-[[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]phenyl]methyl]piperazin-1-yl]-N-propylpyridazine-3-carboxamide |
| SMILES | CCCNC(=O)c1ccc(N2CCN(Cc3ccccc3C#Cc3cncc(O)c3)CC2)nn1 |
| InChI | InChI=1S/C26H28N6O2/c1-2-11-28-26(34)24-9-10-25(30-29-24)32-14-12-31(13-15-32)19-22-6-4-3-5-21(22)8-7-20-16-23(33)18-27-17-20/h3-6,9-10,16-18,33H,2,11-15,19H2,1H3,(H,28,34) |
| InChIKey | DKYZAHNUBQWJFI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|