C30H26N6O4 — CID 169273238
6-[4-[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]benzoyl]piperazin-1-yl]-N-(4-methoxyphenyl)pyridazine-3-carboxamide (PubChem CID 169273238) has the molecular formula C30H26N6O4 and a molecular weight of 534.58 g/mol. Its IUPAC name is 6-[4-[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]benzoyl]piperazin-1-yl]-N-(4-methoxyphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-[4-[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]benzoyl]piperazin-1-yl]-N-(4-methoxyphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169273238 |
| Molecular Formula | C30H26N6O4 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 6-[4-[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]benzoyl]piperazin-1-yl]-N-(4-methoxyphenyl)pyridazine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(N3CCN(C(=O)c4ccccc4C#Cc4cncc(O)c4)CC3)nn2)cc1 |
| InChI | InChI=1S/C30H26N6O4/c1-40-25-10-8-23(9-11-25)32-29(38)27-12-13-28(34-33-27)35-14-16-36(17-15-35)30(39)26-5-3-2-4-22(26)7-6-21-18-24(37)20-31-19-21/h2-5,8-13,18-20,37H,14-17H2,1H3,(H,32,38) |
| InChIKey | NEJNKBMQMKSBNG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|