C26H23N5O4 — CID 169273375
prop-2-enyl 6-[4-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]pyridazine-3-carboxylate (PubChem CID 169273375) has the molecular formula C26H23N5O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is prop-2-enyl 6-[4-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]pyridazine-3-carboxylate.
| Compound Name | prop-2-enyl 6-[4-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 169273375 |
| Molecular Formula | C26H23N5O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | prop-2-enyl 6-[4-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]pyridazine-3-carboxylate |
| SMILES | C=CCOC(=O)c1ccc(N2CCN(C(=O)c3cncc(C#Cc4cccc(O)c4)c3)CC2)nn1 |
| InChI | InChI=1S/C26H23N5O4/c1-2-14-35-26(34)23-8-9-24(29-28-23)30-10-12-31(13-11-30)25(33)21-15-20(17-27-18-21)7-6-19-4-3-5-22(32)16-19/h2-5,8-9,15-18,32H,1,10-14H2 |
| InChIKey | VSTKRGQVXCSOQZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|