C25H21N3O4 — CID 169273165
4-[4-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]benzoic acid (PubChem CID 169273165) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[4-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 169273165 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-[4-[5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(C(=O)c3cncc(C#Cc4cccc(O)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C25H21N3O4/c29-23-3-1-2-18(15-23)4-5-19-14-21(17-26-16-19)24(30)28-12-10-27(11-13-28)22-8-6-20(7-9-22)25(31)32/h1-3,6-9,14-17,29H,10-13H2,(H,31,32) |
| InChIKey | CXJHSARVKNDNEE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|