C32H28N4O4S — CID 170407818
N-benzylsulfinyl-4-[4-[5-[2-(4-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]benzamide (PubChem CID 170407818) has the molecular formula C32H28N4O4S and a molecular weight of 564.67 g/mol. Its IUPAC name is N-benzylsulfinyl-4-[4-[5-[2-(4-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]benzamide.
| Compound Name | N-benzylsulfinyl-4-[4-[5-[2-(4-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 170407818 |
| Molecular Formula | C32H28N4O4S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | N-benzylsulfinyl-4-[4-[5-[2-(4-hydroxyphenyl)ethynyl]pyridine-3-carbonyl]piperazin-1-yl]benzamide |
| SMILES | O=C(NS(=O)Cc1ccccc1)c1ccc(N2CCN(C(=O)c3cncc(C#Cc4ccc(O)cc4)c3)CC2)cc1 |
| InChI | InChI=1S/C32H28N4O4S/c37-30-14-8-24(9-15-30)6-7-26-20-28(22-33-21-26)32(39)36-18-16-35(17-19-36)29-12-10-27(11-13-29)31(38)34-41(40)23-25-4-2-1-3-5-25/h1-5,8-15,20-22,37H,16-19,23H2,(H,34,38) |
| InChIKey | ALBLIAQECKXPCN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|