C37H43N5O2 — CID 169272710
N-(1-adamantylmethyl)-6-[4-[[2-[2-(3-ethoxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 169272710) has the molecular formula C37H43N5O2 and a molecular weight of 589.78 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-6-[4-[[2-[2-(3-ethoxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-6-[4-[[2-[2-(3-ethoxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169272710 |
| Molecular Formula | C37H43N5O2 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | N-(1-adamantylmethyl)-6-[4-[[2-[2-(3-ethoxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | CCOc1cccc(C#Cc2ccccc2CN2CCN(c3ccc(C(=O)NCC45CC6CC(CC(C6)C4)C5)nn3)CC2)c1 |
| InChI | InChI=1S/C37H43N5O2/c1-2-44-33-9-5-6-27(21-33)10-11-31-7-3-4-8-32(31)25-41-14-16-42(17-15-41)35-13-12-34(39-40-35)36(43)38-26-37-22-28-18-29(23-37)20-30(19-28)24-37/h3-9,12-13,21,28-30H,2,14-20,22-26H2,1H3,(H,38,43) |
| InChIKey | NUVZTSRWAYAKMN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|