C30H35N5O4S — CID 169272219
N-tert-butylsulfonyl-6-[4-[[2-[2-(3-ethoxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 169272219) has the molecular formula C30H35N5O4S and a molecular weight of 561.71 g/mol. Its IUPAC name is N-tert-butylsulfonyl-6-[4-[[2-[2-(3-ethoxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-tert-butylsulfonyl-6-[4-[[2-[2-(3-ethoxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169272219 |
| Molecular Formula | C30H35N5O4S |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | N-tert-butylsulfonyl-6-[4-[[2-[2-(3-ethoxyphenyl)ethynyl]phenyl]methyl]piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | CCOc1cccc(C#Cc2ccccc2CN2CCN(c3ccc(C(=O)NS(=O)(=O)C(C)(C)C)nn3)CC2)c1 |
| InChI | InChI=1S/C30H35N5O4S/c1-5-39-26-12-8-9-23(21-26)13-14-24-10-6-7-11-25(24)22-34-17-19-35(20-18-34)28-16-15-27(31-32-28)29(36)33-40(37,38)30(2,3)4/h6-12,15-16,21H,5,17-20,22H2,1-4H3,(H,33,36) |
| InChIKey | VZQFFQAMUJXQDZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|