C29H32N4O4S — CID 169271098
N-tert-butylsulfonyl-4-[4-[[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 169271098) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is N-tert-butylsulfonyl-4-[4-[[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-tert-butylsulfonyl-4-[4-[[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 169271098 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-tert-butylsulfonyl-4-[4-[[2-[2-(5-hydroxy-3-pyridinyl)ethynyl]phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | CC(C)(C)S(=O)(=O)NC(=O)c1ccc(N2CCN(Cc3ccccc3C#Cc3cncc(O)c3)CC2)cc1 |
| InChI | InChI=1S/C29H32N4O4S/c1-29(2,3)38(36,37)31-28(35)24-10-12-26(13-11-24)33-16-14-32(15-17-33)21-25-7-5-4-6-23(25)9-8-22-18-27(34)20-30-19-22/h4-7,10-13,18-20,34H,14-17,21H2,1-3H3,(H,31,35) |
| InChIKey | KFZZUINZGCFXMD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|