C30H30N4O4S — CID 164571146
N-benzylsulfonyl-4-[4-[[2-(5-hydroxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 164571146) has the molecular formula C30H30N4O4S and a molecular weight of 542.66 g/mol. Its IUPAC name is N-benzylsulfonyl-4-[4-[[2-(5-hydroxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-benzylsulfonyl-4-[4-[[2-(5-hydroxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 164571146 |
| Molecular Formula | C30H30N4O4S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | N-benzylsulfonyl-4-[4-[[2-(5-hydroxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | O=C(NS(=O)(=O)Cc1ccccc1)c1ccc(N2CCN(Cc3ccccc3-c3cncc(O)c3)CC2)cc1 |
| InChI | InChI=1S/C30H30N4O4S/c35-28-18-26(19-31-20-28)29-9-5-4-8-25(29)21-33-14-16-34(17-15-33)27-12-10-24(11-13-27)30(36)32-39(37,38)22-23-6-2-1-3-7-23/h1-13,18-20,35H,14-17,21-22H2,(H,32,36) |
| InChIKey | SXAHDLNURLLNSX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |