C32H34N4O2S — CID 170408653
N-benzylsulfanyl-4-[4-[[2-(5-ethoxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 170408653) has the molecular formula C32H34N4O2S and a molecular weight of 538.72 g/mol. Its IUPAC name is N-benzylsulfanyl-4-[4-[[2-(5-ethoxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-benzylsulfanyl-4-[4-[[2-(5-ethoxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 170408653 |
| Molecular Formula | C32H34N4O2S |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | N-benzylsulfanyl-4-[4-[[2-(5-ethoxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | CCOc1cncc(-c2ccccc2CN2CCN(c3ccc(C(=O)NSCc4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C32H34N4O2S/c1-2-38-30-20-28(21-33-22-30)31-11-7-6-10-27(31)23-35-16-18-36(19-17-35)29-14-12-26(13-15-29)32(37)34-39-24-25-8-4-3-5-9-25/h3-15,20-22H,2,16-19,23-24H2,1H3,(H,34,37) |
| InChIKey | MTNQWMWUCRPWKA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|