C27H28N2O3 — CID 169272411
prop-2-enyl 4-[4-[[2-(3-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]benzoate (PubChem CID 169272411) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is prop-2-enyl 4-[4-[[2-(3-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]benzoate.
| Compound Name | prop-2-enyl 4-[4-[[2-(3-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 169272411 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | prop-2-enyl 4-[4-[[2-(3-hydroxyphenyl)phenyl]methyl]piperazin-1-yl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(N2CCN(Cc3ccccc3-c3cccc(O)c3)CC2)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-2-18-32-27(31)21-10-12-24(13-11-21)29-16-14-28(15-17-29)20-23-6-3-4-9-26(23)22-7-5-8-25(30)19-22/h2-13,19,30H,1,14-18,20H2 |
| InChIKey | JFINXCYQQDQPJJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|