C22H22N2O3S — CID 169273270
4-[4-[[4-(3-hydroxyphenyl)thiophen-2-yl]methyl]piperazin-1-yl]benzoic acid (PubChem CID 169273270) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 4-[4-[[4-(3-hydroxyphenyl)thiophen-2-yl]methyl]piperazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[[4-(3-hydroxyphenyl)thiophen-2-yl]methyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 169273270 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-[4-[[4-(3-hydroxyphenyl)thiophen-2-yl]methyl]piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(Cc3cc(-c4cccc(O)c4)cs3)CC2)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c25-20-3-1-2-17(12-20)18-13-21(28-15-18)14-23-8-10-24(11-9-23)19-6-4-16(5-7-19)22(26)27/h1-7,12-13,15,25H,8-11,14H2,(H,26,27) |
| InChIKey | DYFHYUAOOATGSS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |