C28H31N3O3 — CID 169272852
prop-2-enyl 4-[4-[[2-ethyl-4-(5-hydroxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzoate (PubChem CID 169272852) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is prop-2-enyl 4-[4-[[2-ethyl-4-(5-hydroxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzoate.
| Compound Name | prop-2-enyl 4-[4-[[2-ethyl-4-(5-hydroxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 169272852 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | prop-2-enyl 4-[4-[[2-ethyl-4-(5-hydroxy-3-pyridinyl)phenyl]methyl]piperazin-1-yl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(N2CCN(Cc3ccc(-c4cncc(O)c4)cc3CC)CC2)cc1 |
| InChI | InChI=1S/C28H31N3O3/c1-3-15-34-28(33)22-7-9-26(10-8-22)31-13-11-30(12-14-31)20-24-6-5-23(16-21(24)4-2)25-17-27(32)19-29-18-25/h3,5-10,16-19,32H,1,4,11-15,20H2,2H3 |
| InChIKey | AQPHZVVKPRAXLW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|