C38H39N3O5S — CID 164571128
N-benzylsulfonyl-4-[4-[[2-[2-[4-(oxan-2-yloxy)phenyl]ethynyl]phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 164571128) has the molecular formula C38H39N3O5S and a molecular weight of 649.81 g/mol. Its IUPAC name is N-benzylsulfonyl-4-[4-[[2-[2-[4-(oxan-2-yloxy)phenyl]ethynyl]phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-benzylsulfonyl-4-[4-[[2-[2-[4-(oxan-2-yloxy)phenyl]ethynyl]phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 164571128 |
| Molecular Formula | C38H39N3O5S |
| Molecular Weight | 649.81 g/mol |
| Exact Mass | 649.26 |
| IUPAC Name | N-benzylsulfonyl-4-[4-[[2-[2-[4-(oxan-2-yloxy)phenyl]ethynyl]phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | O=C(NS(=O)(=O)Cc1ccccc1)c1ccc(N2CCN(Cc3ccccc3C#Cc3ccc(OC4CCCCO4)cc3)CC2)cc1 |
| InChI | InChI=1S/C38H39N3O5S/c42-38(39-47(43,44)29-31-8-2-1-3-9-31)33-17-19-35(20-18-33)41-25-23-40(24-26-41)28-34-11-5-4-10-32(34)16-13-30-14-21-36(22-15-30)46-37-12-6-7-27-45-37/h1-5,8-11,14-15,17-22,37H,6-7,12,23-29H2,(H,39,42) |
| InChIKey | RLDJEUHVIACOAS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.81 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|