C29H31N5O3 — CID 59697625
N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[(4-phenylpiperazin-1-yl)methyl]phenyl]ethynyl]benzamide (PubChem CID 59697625) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[(4-phenylpiperazin-1-yl)methyl]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[(4-phenylpiperazin-1-yl)methyl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59697625 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-1-oxopropan-2-yl]-4-[2-[4-[(4-phenylpiperazin-1-yl)methyl]phenyl]ethynyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(C#Cc2ccc(CN3CCN(c4ccccc4)CC3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C29H31N5O3/c30-20-27(29(36)32-37)31-28(35)25-14-12-23(13-15-25)7-6-22-8-10-24(11-9-22)21-33-16-18-34(19-17-33)26-4-2-1-3-5-26/h1-5,8-15,27,37H,16-21,30H2,(H,31,35)(H,32,36)/t27-/m0/s1 |
| InChIKey | LEMDZAVKINTFNI-MHZLTWQESA-N |
| XLogP | 1.97 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|