C39H43N3O5S — CID 169272547
N-(1-adamantylmethylsulfonyl)-4-[4-[2-[2-(3-ethoxyphenyl)ethynyl]benzoyl]piperazin-1-yl]benzamide (PubChem CID 169272547) has the molecular formula C39H43N3O5S and a molecular weight of 665.86 g/mol. Its IUPAC name is N-(1-adamantylmethylsulfonyl)-4-[4-[2-[2-(3-ethoxyphenyl)ethynyl]benzoyl]piperazin-1-yl]benzamide.
| Compound Name | N-(1-adamantylmethylsulfonyl)-4-[4-[2-[2-(3-ethoxyphenyl)ethynyl]benzoyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 169272547 |
| Molecular Formula | C39H43N3O5S |
| Molecular Weight | 665.86 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | N-(1-adamantylmethylsulfonyl)-4-[4-[2-[2-(3-ethoxyphenyl)ethynyl]benzoyl]piperazin-1-yl]benzamide |
| SMILES | CCOc1cccc(C#Cc2ccccc2C(=O)N2CCN(c3ccc(C(=O)NS(=O)(=O)CC45CC6CC(CC(C6)C4)C5)cc3)CC2)c1 |
| InChI | InChI=1S/C39H43N3O5S/c1-2-47-35-8-5-6-28(23-35)10-11-32-7-3-4-9-36(32)38(44)42-18-16-41(17-19-42)34-14-12-33(13-15-34)37(43)40-48(45,46)27-39-24-29-20-30(25-39)22-31(21-29)26-39/h3-9,12-15,23,29-31H,2,16-22,24-27H2,1H3,(H,40,43) |
| InChIKey | YUPLSUYHBCSECG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.86 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|