C21H31NO3 — CID 169276307
tert-butyl N-[4-[(4-methoxy-1-bicyclo[2.2.2]octanyl)methyl]phenyl]carbamate (PubChem CID 169276307) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-methoxy-1-bicyclo[2.2.2]octanyl)methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-methoxy-1-bicyclo[2.2.2]octanyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 169276307 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl N-[4-[(4-methoxy-1-bicyclo[2.2.2]octanyl)methyl]phenyl]carbamate |
| SMILES | COC12CCC(Cc3ccc(NC(=O)OC(C)(C)C)cc3)(CC1)CC2 |
| InChI | InChI=1S/C21H31NO3/c1-19(2,3)25-18(23)22-17-7-5-16(6-8-17)15-20-9-12-21(24-4,13-10-20)14-11-20/h5-8H,9-15H2,1-4H3,(H,22,23) |
| InChIKey | DVIUCILWCXPPSK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |