C15H7Cl2N3O — CID 169280034
2,4-dichloro-6-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)-1,3,5-triazine (PubChem CID 169280034) has the molecular formula C15H7Cl2N3O and a molecular weight of 323.19 g/mol. Its IUPAC name is 2,4-dichloro-6-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)-1,3,5-triazine.
| Compound Name | 2,4-dichloro-6-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169280034 |
| Molecular Formula | C15H7Cl2N3O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2,4-dichloro-6-(1,2,3,6,7,8,9-heptadeuteriodibenzofuran-4-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(oc3c(-c4nc(Cl)nc(Cl)n4)c([2H])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C15H7Cl2N3O/c16-14-18-13(19-15(17)20-14)10-6-3-5-9-8-4-1-2-7-11(8)21-12(9)10/h1-7H/i1D,2D,3D,4D,5D,6D,7D |
| InChIKey | LYULOEZHJLAQKR-GSNKEKJESA-N |
| XLogP | 4.74 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |