C27H16ClN3 — CID 171598376
2-chloro-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-(1,3,4,5,6,7,8,9,10-nonadeuterioanthracen-2-yl)-1,3,5-triazine (PubChem CID 171598376) has the molecular formula C27H16ClN3 and a molecular weight of 434.00 g/mol. Its IUPAC name is 2-chloro-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-(1,3,4,5,6,7,8,9,10-nonadeuterioanthracen-2-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-(1,3,4,5,6,7,8,9,10-nonadeuterioanthracen-2-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171598376 |
| Molecular Formula | C27H16ClN3 |
| Molecular Weight | 434.00 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-chloro-4-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)-6-(1,3,4,5,6,7,8,9,10-nonadeuterioanthracen-2-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3nc(Cl)nc(-c4c([2H])c([2H])c5c([2H])c6c([2H])c([2H])c([2H])c([2H])c6c([2H])c5c4[2H])n3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C27H16ClN3/c28-27-30-25(29-26(31-27)24-11-5-9-17-6-3-4-10-23(17)24)21-13-12-20-14-18-7-1-2-8-19(18)15-22(20)16-21/h1-16H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D |
| InChIKey | QWQWBZSSJDXLHJ-NYCJPCIFSA-N |
| XLogP | 7.32 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.00 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|