C46H31N3O — CID 169281799
2-[3-(6H-benzo[c]chromen-10-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 169281799) has the molecular formula C46H31N3O and a molecular weight of 641.77 g/mol. Its IUPAC name is 2-[3-(6H-benzo[c]chromen-10-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(6H-benzo[c]chromen-10-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169281799 |
| Molecular Formula | C46H31N3O |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.25 |
| IUPAC Name | 2-[3-(6H-benzo[c]chromen-10-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(-c5cccc6c5-c5ccccc5OC6)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C46H31N3O/c1-3-11-31(12-4-1)33-21-25-35(26-22-33)44-47-45(36-27-23-34(24-28-36)32-13-5-2-6-14-32)49-46(48-44)38-16-9-15-37(29-38)40-19-10-17-39-30-50-42-20-8-7-18-41(42)43(39)40/h1-29H,30H2 |
| InChIKey | DQSLDAYDMOHAKI-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |