C46H31N3O — CID 169281789
2-[3-(6,6-dideuteriobenzo[c]chromen-1-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 169281789) has the molecular formula C46H31N3O and a molecular weight of 643.79 g/mol. Its IUPAC name is 2-[3-(6,6-dideuteriobenzo[c]chromen-1-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-(6,6-dideuteriobenzo[c]chromen-1-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 169281789 |
| Molecular Formula | C46H31N3O |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.26 |
| IUPAC Name | 2-[3-(6,6-dideuteriobenzo[c]chromen-1-yl)phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]C1([2H])Oc2cccc(-c3cccc(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5ccc(-c6ccccc6)cc5)n4)c3)c2-c2ccccc21 |
| InChI | InChI=1S/C46H31N3O/c1-3-11-31(12-4-1)33-21-25-35(26-22-33)44-47-45(36-27-23-34(24-28-36)32-13-5-2-6-14-32)49-46(48-44)38-17-9-16-37(29-38)40-19-10-20-42-43(40)41-18-8-7-15-39(41)30-50-42/h1-29H,30H2/i30D2 |
| InChIKey | HEBRZCZBWNTKAW-GQSUAVQFSA-N |
| XLogP | 11.43 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |