C30H26I5O6- — CID 169283559
1-(ethoxymethoxy)-4-[4-[4-[4-(ethoxymethoxy)-2,5-diiodophenoxy]phenyl]iodanuidylphenoxy]-2,5-diiodobenzene (PubChem CID 169283559) has the molecular formula C30H26I5O6- and a molecular weight of 1117.05 g/mol. Its IUPAC name is 1-(ethoxymethoxy)-4-[4-[4-[4-(ethoxymethoxy)-2,5-diiodophenoxy]phenyl]iodanuidylphenoxy]-2,5-diiodobenzene.
| Compound Name | 1-(ethoxymethoxy)-4-[4-[4-[4-(ethoxymethoxy)-2,5-diiodophenoxy]phenyl]iodanuidylphenoxy]-2,5-diiodobenzene |
|---|---|
| PubChem CID | 169283559 |
| Molecular Formula | C30H26I5O6- |
| Molecular Weight | 1117.05 g/mol |
| Exact Mass | 1116.70 |
| IUPAC Name | 1-(ethoxymethoxy)-4-[4-[4-[4-(ethoxymethoxy)-2,5-diiodophenoxy]phenyl]iodanuidylphenoxy]-2,5-diiodobenzene |
| SMILES | CCOCOc1cc(I)c(Oc2ccc([I-]c3ccc(Oc4cc(I)c(OCOCC)cc4I)cc3)cc2)cc1I |
| InChI | InChI=1S/C30H26I5O6/c1-3-36-17-38-27-13-25(33)29(15-23(27)31)40-21-9-5-19(6-10-21)35-20-7-11-22(12-8-20)41-30-16-24(32)28(14-26(30)34)39-18-37-4-2/h5-16H,3-4,17-18H2,1-2H3/q-1 |
| InChIKey | GPHMBUUAKLKDKZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.05 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|