C11H15IO2 — CID 155284614
1-(ethoxymethoxy)-2-iodo-3,5-dimethylbenzene (PubChem CID 155284614) has the molecular formula C11H15IO2 and a molecular weight of 306.14 g/mol. Its IUPAC name is 1-(ethoxymethoxy)-2-iodo-3,5-dimethylbenzene.
| Compound Name | 1-(ethoxymethoxy)-2-iodo-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 155284614 |
| Molecular Formula | C11H15IO2 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 1-(ethoxymethoxy)-2-iodo-3,5-dimethylbenzene |
| SMILES | CCOCOc1cc(C)cc(C)c1I |
| InChI | InChI=1S/C11H15IO2/c1-4-13-7-14-10-6-8(2)5-9(3)11(10)12/h5-6H,4,7H2,1-3H3 |
| InChIKey | NUBXGUDALMRAIR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|