C62H53NO2 — CID 169286020
2',7'-bis(4-deuteriooxan-4-yl)-N-(9,9-dimethylfluoren-2-yl)-N-(2-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine (PubChem CID 169286020) has the molecular formula C62H53NO2 and a molecular weight of 846.12 g/mol. Its IUPAC name is 2',7'-bis(4-deuteriooxan-4-yl)-N-(9,9-dimethylfluoren-2-yl)-N-(2-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine.
| Compound Name | 2',7'-bis(4-deuteriooxan-4-yl)-N-(9,9-dimethylfluoren-2-yl)-N-(2-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine |
|---|---|
| PubChem CID | 169286020 |
| Molecular Formula | C62H53NO2 |
| Molecular Weight | 846.12 g/mol |
| Exact Mass | 845.42 |
| IUPAC Name | 2',7'-bis(4-deuteriooxan-4-yl)-N-(9,9-dimethylfluoren-2-yl)-N-(2-phenylphenyl)-9,9'-spirobi[fluorene]-4-amine |
| SMILES | [2H]C1(c2ccc3c(c2)C2(c4cc(C5([2H])CCOCC5)ccc4-3)c3ccccc3-c3c(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccccc4-c4ccccc4)cccc32)CCOCC1 |
| InChI | InChI=1S/C62H53NO2/c1-61(2)52-18-9-6-16-47(52)48-28-25-45(39-55(48)61)63(58-21-11-8-15-46(58)42-13-4-3-5-14-42)59-22-12-20-54-60(59)51-17-7-10-19-53(51)62(54)56-37-43(40-29-33-64-34-30-40)23-26-49(56)50-27-24-44(38-57(50)62)41-31-35-65-36-32-41/h3-28,37-41H,29-36H2,1-2H3/i40D,41D |
| InChIKey | PMANIJAREVMUKD-SXDSJLLZSA-N |
| XLogP | 15.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.12 |
| LogP ≤ 5 | 15.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |