C70H69N — CID 169286046
N-(9,9-dimethylfluoren-2-yl)-N-(2-phenylphenyl)-2',7'-bis(1,4,4-trimethylcyclohexyl)-9,9'-spirobi[fluorene]-4-amine (PubChem CID 169286046) has the molecular formula C70H69N and a molecular weight of 924.33 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-N-(2-phenylphenyl)-2',7'-bis(1,4,4-trimethylcyclohexyl)-9,9'-spirobi[fluorene]-4-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-N-(2-phenylphenyl)-2',7'-bis(1,4,4-trimethylcyclohexyl)-9,9'-spirobi[fluorene]-4-amine |
|---|---|
| PubChem CID | 169286046 |
| Molecular Formula | C70H69N |
| Molecular Weight | 924.33 g/mol |
| Exact Mass | 923.54 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-N-(2-phenylphenyl)-2',7'-bis(1,4,4-trimethylcyclohexyl)-9,9'-spirobi[fluorene]-4-amine |
| SMILES | CC1(C)CCC(C)(c2ccc3c(c2)C2(c4cc(C5(C)CCC(C)(C)CC5)ccc4-3)c3ccccc3-c3c(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccccc4-c4ccccc4)cccc32)CC1 |
| InChI | InChI=1S/C70H69N/c1-65(2)35-39-68(7,40-36-65)47-29-32-53-54-33-30-48(69(8)41-37-66(3,4)38-42-69)44-61(54)70(60(53)43-47)57-25-16-13-23-55(57)64-58(70)26-18-28-63(64)71(62-27-17-14-21-50(62)46-19-10-9-11-20-46)49-31-34-52-51-22-12-15-24-56(51)67(5,6)59(52)45-49/h9-34,43-45H,35-42H2,1-8H3 |
| InChIKey | UWPDVXWNIBNEKR-UHFFFAOYSA-N |
| XLogP | 19.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.33 |
| LogP ≤ 5 | 19.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |