C44H22N4S2 — CID 169287193
3,5-bis([1]benzothiolo[2,3-b]carbazol-7-yl)-4-isocyanobenzonitrile (PubChem CID 169287193) has the molecular formula C44H22N4S2 and a molecular weight of 670.82 g/mol. Its IUPAC name is 3,5-bis([1]benzothiolo[2,3-b]carbazol-7-yl)-4-isocyanobenzonitrile.
| Compound Name | 3,5-bis([1]benzothiolo[2,3-b]carbazol-7-yl)-4-isocyanobenzonitrile |
|---|---|
| PubChem CID | 169287193 |
| Molecular Formula | C44H22N4S2 |
| Molecular Weight | 670.82 g/mol |
| Exact Mass | 670.13 |
| IUPAC Name | 3,5-bis([1]benzothiolo[2,3-b]carbazol-7-yl)-4-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(-n2c3ccccc3c3cc4c(cc32)sc2ccccc24)cc(C#N)cc1-n1c2ccccc2c2cc3c(cc21)sc1ccccc13 |
| InChI | InChI=1S/C44H22N4S2/c1-46-44-38(47-34-14-6-2-10-26(34)30-20-32-28-12-4-8-16-40(28)49-42(32)22-36(30)47)18-25(24-45)19-39(44)48-35-15-7-3-11-27(35)31-21-33-29-13-5-9-17-41(29)50-43(33)23-37(31)48/h2-23H |
| InChIKey | WXGGQHALZOUJNL-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 38.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.82 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|