C51H37N9 — CID 169296997
2,5-bis[4-[4-(2,6-dimethyl-3-pyridinyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 169296997) has the molecular formula C51H37N9 and a molecular weight of 775.92 g/mol. Its IUPAC name is 2,5-bis[4-[4-(2,6-dimethyl-3-pyridinyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 2,5-bis[4-[4-(2,6-dimethyl-3-pyridinyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 169296997 |
| Molecular Formula | C51H37N9 |
| Molecular Weight | 775.92 g/mol |
| Exact Mass | 775.32 |
| IUPAC Name | 2,5-bis[4-[4-(2,6-dimethyl-3-pyridinyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7ccc(C)nc7C)n6)cc5)c(C#N)c4)cc3)n2)c(C)n1 |
| InChI | InChI=1S/C51H37N9/c1-31-15-26-43(33(3)53-31)50-57-46(37-11-7-5-8-12-37)55-48(59-50)39-21-17-35(18-22-39)41-25-28-45(42(29-41)30-52)36-19-23-40(24-20-36)49-56-47(38-13-9-6-10-14-38)58-51(60-49)44-27-16-32(2)54-34(44)4/h5-29H,1-4H3 |
| InChIKey | VXBAPSYTYAKRGM-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 126.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.92 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |