C22H24F2N6O2 — CID 169299773
4-fluoro-6-[6-[[(2R,3S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-7-hydroxy-2-(1,1,2,2,2-pentadeuterioethyl)isoquinolin-1-one (PubChem CID 169299773) has the molecular formula C22H24F2N6O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 4-fluoro-6-[6-[[(2R,3S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-7-hydroxy-2-(1,1,2,2,2-pentadeuterioethyl)isoquinolin-1-one.
| Compound Name | 4-fluoro-6-[6-[[(2R,3S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-7-hydroxy-2-(1,1,2,2,2-pentadeuterioethyl)isoquinolin-1-one |
|---|---|
| PubChem CID | 169299773 |
| Molecular Formula | C22H24F2N6O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-fluoro-6-[6-[[(2R,3S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-7-hydroxy-2-(1,1,2,2,2-pentadeuterioethyl)isoquinolin-1-one |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])n1cc(F)c2cc(-c3ncc(N(C)[C@H]4CC5CCC(N5)[C@H]4F)nn3)c(O)cc2c1=O |
| InChI | InChI=1S/C22H24F2N6O2/c1-3-30-10-15(23)12-7-14(18(31)8-13(12)22(30)32)21-25-9-19(27-28-21)29(2)17-6-11-4-5-16(26-11)20(17)24/h7-11,16-17,20,26,31H,3-6H2,1-2H3/t11?,16?,17-,20+/m0/s1/i1D3,3D2 |
| InChIKey | MJLCOYNRZBVEBG-KOGSFPRRSA-N |
| XLogP | 2.39 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |