C25H24N8O — CID 169300432
N-[[4-(6-aminopurin-9-yl)phenyl]methyl]-5-benzyl-1-ethylpyrazole-4-carboxamide (PubChem CID 169300432) has the molecular formula C25H24N8O and a molecular weight of 452.52 g/mol. Its IUPAC name is N-[[4-(6-aminopurin-9-yl)phenyl]methyl]-5-benzyl-1-ethylpyrazole-4-carboxamide.
| Compound Name | N-[[4-(6-aminopurin-9-yl)phenyl]methyl]-5-benzyl-1-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 169300432 |
| Molecular Formula | C25H24N8O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[[4-(6-aminopurin-9-yl)phenyl]methyl]-5-benzyl-1-ethylpyrazole-4-carboxamide |
| SMILES | CCn1ncc(C(=O)NCc2ccc(-n3cnc4c(N)ncnc43)cc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C25H24N8O/c1-2-33-21(12-17-6-4-3-5-7-17)20(14-31-33)25(34)27-13-18-8-10-19(11-9-18)32-16-30-22-23(26)28-15-29-24(22)32/h3-11,14-16H,2,12-13H2,1H3,(H,27,34)(H2,26,28,29) |
| InChIKey | NKJUONLBVYNPGO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |