C25H21ClN8O — CID 170040705
N-[[4-(6-aminopurin-9-yl)cyclohepta-2,4-dien-6-yn-1-yl]methyl]-5-benzyl-3-chloro-1-methylpyrazole-4-carboxamide (PubChem CID 170040705) has the molecular formula C25H21ClN8O and a molecular weight of 484.95 g/mol. Its IUPAC name is N-[[4-(6-aminopurin-9-yl)cyclohepta-2,4-dien-6-yn-1-yl]methyl]-5-benzyl-3-chloro-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[[4-(6-aminopurin-9-yl)cyclohepta-2,4-dien-6-yn-1-yl]methyl]-5-benzyl-3-chloro-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 170040705 |
| Molecular Formula | C25H21ClN8O |
| Molecular Weight | 484.95 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-[[4-(6-aminopurin-9-yl)cyclohepta-2,4-dien-6-yn-1-yl]methyl]-5-benzyl-3-chloro-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1nc(Cl)c(C(=O)NCC2C#CC=C(n3cnc4c(N)ncnc43)C=C2)c1Cc1ccccc1 |
| InChI | InChI=1S/C25H21ClN8O/c1-33-19(12-16-6-3-2-4-7-16)20(22(26)32-33)25(35)28-13-17-8-5-9-18(11-10-17)34-15-31-21-23(27)29-14-30-24(21)34/h2-4,6-7,9-11,14-15,17H,12-13H2,1H3,(H,28,35)(H2,27,29,30) |
| InChIKey | CRPUKCYSAKDEED-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.95 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|