C28H29FN3S+ — CID 169301049
6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-2-fluoro-5-methyl-1,3-benzothiazole (PubChem CID 169301049) has the molecular formula C28H29FN3S+ and a molecular weight of 458.63 g/mol. Its IUPAC name is 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-2-fluoro-5-methyl-1,3-benzothiazole.
| Compound Name | 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-2-fluoro-5-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 169301049 |
| Molecular Formula | C28H29FN3S+ |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 6-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-2-fluoro-5-methyl-1,3-benzothiazole |
| SMILES | Cc1cc2nc(F)sc2cc1-c1n(-c2c(C(C)C)cccc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C28H29FN3S/c1-16(2)19-10-9-11-20(17(3)4)26(19)32-24-13-8-7-12-23(24)31(6)27(32)21-15-25-22(14-18(21)5)30-28(29)33-25/h7-17H,1-6H3/q+1 |
| InChIKey | SVEYXOSTJMTNNP-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|