C37H44F3N7O3Si — CID 169304253
N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-4-methyl-3-[3-(2-trimethylsilylethoxymethyl)imidazo[4,5-g]quinazolin-8-yl]oxybenzamide (PubChem CID 169304253) has the molecular formula C37H44F3N7O3Si and a molecular weight of 719.89 g/mol. Its IUPAC name is N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-4-methyl-3-[3-(2-trimethylsilylethoxymethyl)imidazo[4,5-g]quinazolin-8-yl]oxybenzamide.
| Compound Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-4-methyl-3-[3-(2-trimethylsilylethoxymethyl)imidazo[4,5-g]quinazolin-8-yl]oxybenzamide |
|---|---|
| PubChem CID | 169304253 |
| Molecular Formula | C37H44F3N7O3Si |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.32 |
| IUPAC Name | N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-4-methyl-3-[3-(2-trimethylsilylethoxymethyl)imidazo[4,5-g]quinazolin-8-yl]oxybenzamide |
| SMILES | CCN1CCN(Cc2ccc(NC(=O)c3ccc(C)c(Oc4ncnc5cc6c(cc45)ncn6COCC[Si](C)(C)C)c3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C37H44F3N7O3Si/c1-6-45-11-13-46(14-12-45)21-27-9-10-28(18-30(27)37(38,39)40)44-35(48)26-8-7-25(2)34(17-26)50-36-29-19-32-33(20-31(29)41-22-42-36)47(23-43-32)24-49-15-16-51(3,4)5/h7-10,17-20,22-23H,6,11-16,21,24H2,1-5H3,(H,44,48) |
| InChIKey | FLRUFGSJEROPKO-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|