C23H25F3N2O6S — CID 169307967
(1S,6R)-N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-6-(hydroxymethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 169307967) has the molecular formula C23H25F3N2O6S and a molecular weight of 514.52 g/mol. Its IUPAC name is (1S,6R)-N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-6-(hydroxymethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6R)-N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-6-(hydroxymethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 169307967 |
| Molecular Formula | C23H25F3N2O6S |
| Molecular Weight | 514.52 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | (1S,6R)-N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-6-(hydroxymethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | CCOc1cc(NC(=O)[C@H]2CC=CC[C@H]2CO)ccc1S(=O)(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C23H25F3N2O6S/c1-2-33-20-13-16(27-22(30)19-9-4-3-6-15(19)14-29)10-11-21(20)35(31,32)28-17-7-5-8-18(12-17)34-23(24,25)26/h3-5,7-8,10-13,15,19,28-29H,2,6,9,14H2,1H3,(H,27,30)/t15-,19-/m0/s1 |
| InChIKey | YDZZUULBHDMOOK-KXBFYZLASA-N |
| XLogP | 4.30 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|