C22H25F3N2O6S — CID 169307988
N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-2-(hydroxymethyl)-4-methylpent-4-enamide (PubChem CID 169307988) has the molecular formula C22H25F3N2O6S and a molecular weight of 502.51 g/mol. Its IUPAC name is N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-2-(hydroxymethyl)-4-methylpent-4-enamide.
| Compound Name | N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-2-(hydroxymethyl)-4-methylpent-4-enamide |
|---|---|
| PubChem CID | 169307988 |
| Molecular Formula | C22H25F3N2O6S |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | N-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]-2-(hydroxymethyl)-4-methylpent-4-enamide |
| SMILES | C=C(C)CC(CO)C(=O)Nc1ccc(S(=O)(=O)Nc2cccc(OC(F)(F)F)c2)c(OCC)c1 |
| InChI | InChI=1S/C22H25F3N2O6S/c1-4-32-19-12-16(26-21(29)15(13-28)10-14(2)3)8-9-20(19)34(30,31)27-17-6-5-7-18(11-17)33-22(23,24)25/h5-9,11-12,15,27-28H,2,4,10,13H2,1,3H3,(H,26,29) |
| InChIKey | KQGFSDUUYTUWOI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|