C24H27F3N2O7S — CID 169308158
2-cyclohexyl-3-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]anilino]-3-oxopropanoic acid (PubChem CID 169308158) has the molecular formula C24H27F3N2O7S and a molecular weight of 544.55 g/mol. Its IUPAC name is 2-cyclohexyl-3-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]anilino]-3-oxopropanoic acid.
| Compound Name | 2-cyclohexyl-3-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 169308158 |
| Molecular Formula | C24H27F3N2O7S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 2-cyclohexyl-3-[3-ethoxy-4-[[3-(trifluoromethoxy)phenyl]sulfamoyl]anilino]-3-oxopropanoic acid |
| SMILES | CCOc1cc(NC(=O)C(C(=O)O)C2CCCCC2)ccc1S(=O)(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H27F3N2O7S/c1-2-35-19-14-16(28-22(30)21(23(31)32)15-7-4-3-5-8-15)11-12-20(19)37(33,34)29-17-9-6-10-18(13-17)36-24(25,26)27/h6,9-15,21,29H,2-5,7-8H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | IMRFJEUKNYXFSX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|