C23H27F2N2O6PS2 — CID 170341684
S-methyl 2-cyclobutyl-3-[4-[[3-[difluoro(phosphanyl)methoxy]phenyl]sulfamoyl]-3-ethoxyanilino]-3-oxopropanethioate (PubChem CID 170341684) has the molecular formula C23H27F2N2O6PS2 and a molecular weight of 560.58 g/mol. Its IUPAC name is S-methyl 2-cyclobutyl-3-[4-[[3-[difluoro(phosphanyl)methoxy]phenyl]sulfamoyl]-3-ethoxyanilino]-3-oxopropanethioate.
| Compound Name | S-methyl 2-cyclobutyl-3-[4-[[3-[difluoro(phosphanyl)methoxy]phenyl]sulfamoyl]-3-ethoxyanilino]-3-oxopropanethioate |
|---|---|
| PubChem CID | 170341684 |
| Molecular Formula | C23H27F2N2O6PS2 |
| Molecular Weight | 560.58 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | S-methyl 2-cyclobutyl-3-[4-[[3-[difluoro(phosphanyl)methoxy]phenyl]sulfamoyl]-3-ethoxyanilino]-3-oxopropanethioate |
| SMILES | CCOc1cc(NC(=O)C(C(=O)SC)C2CCC2)ccc1S(=O)(=O)Nc1cccc(OC(F)(F)P)c1 |
| InChI | InChI=1S/C23H27F2N2O6PS2/c1-3-32-18-13-15(26-21(28)20(22(29)35-2)14-6-4-7-14)10-11-19(18)36(30,31)27-16-8-5-9-17(12-16)33-23(24,25)34/h5,8-14,20,27H,3-4,6-7,34H2,1-2H3,(H,26,28) |
| InChIKey | ZTCBECXCFOFHRO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|