C20H24N2O3S — CID 16930897
N-(2-ethylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)-2,5-dimethylbenzamide (PubChem CID 16930897) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(2-ethylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)-2,5-dimethylbenzamide.
| Compound Name | N-(2-ethylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 16930897 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-(2-ethylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)-2,5-dimethylbenzamide |
| SMILES | CCS(=O)(=O)N1CCc2ccc(NC(=O)c3cc(C)ccc3C)cc2C1 |
| InChI | InChI=1S/C20H24N2O3S/c1-4-26(24,25)22-10-9-16-7-8-18(12-17(16)13-22)21-20(23)19-11-14(2)5-6-15(19)3/h5-8,11-12H,4,9-10,13H2,1-3H3,(H,21,23) |
| InChIKey | XGIRDADHXYZCAW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |