C29H43NO2 — CID 169312446
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-[3-(hydroxymethyl)-2-pyridinyl]butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169312446) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-[3-(hydroxymethyl)-2-pyridinyl]butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-[3-(hydroxymethyl)-2-pyridinyl]butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169312446 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-[3-(hydroxymethyl)-2-pyridinyl]butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCc1ncccc1CO)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H43NO2/c1-19(6-11-27-20(18-31)5-4-16-30-27)24-9-10-25-23-8-7-21-17-22(32)12-14-28(21,2)26(23)13-15-29(24,25)3/h4-5,7,16,19,22-26,31-32H,6,8-15,17-18H2,1-3H3/t19-,22+,23+,24-,25+,26+,28+,29-/m1/s1 |
| InChIKey | ZZDJDMMSFPXVHM-HSIBUNQISA-N |
| XLogP | 6.08 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|