C29H43NO — CID 170306251
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[4-(3-methyl-2-pyridinyl)butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 170306251) has the molecular formula C29H43NO and a molecular weight of 421.67 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[4-(3-methyl-2-pyridinyl)butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[4-(3-methyl-2-pyridinyl)butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 170306251 |
| Molecular Formula | C29H43NO |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[4-(3-methyl-2-pyridinyl)butan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | Cc1cccnc1CCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H43NO/c1-19(7-12-27-20(2)6-5-17-30-27)24-10-11-25-23-9-8-21-18-22(31)13-15-28(21,3)26(23)14-16-29(24,25)4/h5-6,8,17,19,22-26,31H,7,9-16,18H2,1-4H3/t19?,22-,23-,24+,25-,26-,28-,29+/m0/s1 |
| InChIKey | NBZQZSXHBHHYKZ-SWYSWKSLSA-N |
| XLogP | 6.90 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|