C32H46O — CID 17369971
(3R,10S,13S)-10,13-dimethyl-17-[(E)-6-phenylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 17369971) has the molecular formula C32H46O and a molecular weight of 446.72 g/mol. Its IUPAC name is (3R,10S,13S)-10,13-dimethyl-17-[(E)-6-phenylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,10S,13S)-10,13-dimethyl-17-[(E)-6-phenylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 17369971 |
| Molecular Formula | C32H46O |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.35 |
| IUPAC Name | (3R,10S,13S)-10,13-dimethyl-17-[(E)-6-phenylhept-5-en-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C/C(=C\CCC(C)C1CCC2C3CC=C4C[C@H](O)CC[C@@]4(C)C3CC[C@@]12C)c1ccccc1 |
| InChI | InChI=1S/C32H46O/c1-22(24-11-6-5-7-12-24)9-8-10-23(2)28-15-16-29-27-14-13-25-21-26(33)17-19-31(25,3)30(27)18-20-32(28,29)4/h5-7,9,11-13,23,26-30,33H,8,10,14-21H2,1-4H3/b22-9+/t23?,26-,27?,28?,29?,30?,31-,32+/m1/s1 |
| InChIKey | KGICHBLSYNZKLD-PWKMXXBRSA-N |
| XLogP | 8.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|