C21H24N4O3S — CID 16931487
2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]acetamide (PubChem CID 16931487) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]acetamide |
|---|---|
| PubChem CID | 16931487 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]acetamide |
| SMILES | CN1CCN(C(CNC(=O)CN2C(=O)c3ccccc3C2=O)c2ccsc2)CC1 |
| InChI | InChI=1S/C21H24N4O3S/c1-23-7-9-24(10-8-23)18(15-6-11-29-14-15)12-22-19(26)13-25-20(27)16-4-2-3-5-17(16)21(25)28/h2-6,11,14,18H,7-10,12-13H2,1H3,(H,22,26) |
| InChIKey | PVNCZJDMXXJJJQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|