C25H29N3OS — CID 16931437
N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16931437) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16931437 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-2-(4-phenylphenyl)acetamide |
| SMILES | CN1CCN(C(CNC(=O)Cc2ccc(-c3ccccc3)cc2)c2ccsc2)CC1 |
| InChI | InChI=1S/C25H29N3OS/c1-27-12-14-28(15-13-27)24(23-11-16-30-19-23)18-26-25(29)17-20-7-9-22(10-8-20)21-5-3-2-4-6-21/h2-11,16,19,24H,12-15,17-18H2,1H3,(H,26,29) |
| InChIKey | KCIOOJPKDJETPK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |